C21H27N2O2+ — CID 7317441
1-[(2-hydroxyphenyl)methyl]-N-(2-phenylethyl)piperidin-1-ium-4-carboxamide (PubChem CID 7317441) has the molecular formula C21H27N2O2+ and a molecular weight of 339.46 g/mol. Its IUPAC name is 1-[(2-hydroxyphenyl)methyl]-N-(2-phenylethyl)piperidin-1-ium-4-carboxamide.
| Compound Name | 1-[(2-hydroxyphenyl)methyl]-N-(2-phenylethyl)piperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7317441 |
| Molecular Formula | C21H27N2O2+ |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.21 |
| IUPAC Name | 1-[(2-hydroxyphenyl)methyl]-N-(2-phenylethyl)piperidin-1-ium-4-carboxamide |
| SMILES | O=C(NCCc1ccccc1)C1CC[NH+](Cc2ccccc2O)CC1 |
| InChI | InChI=1S/C21H26N2O2/c24-20-9-5-4-8-19(20)16-23-14-11-18(12-15-23)21(25)22-13-10-17-6-2-1-3-7-17/h1-9,18,24H,10-16H2,(H,22,25)/p+1 |
| InChIKey | GAKKYHKKULWQJK-UHFFFAOYSA-O |
| XLogP | 1.55 |
| TPSA | 53.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|