C22H28ClN2O+ — CID 7334890
N-benzyl-1-[(2-chlorophenyl)methyl]-N-ethylpiperidin-1-ium-4-carboxamide (PubChem CID 7334890) has the molecular formula C22H28ClN2O+ and a molecular weight of 371.93 g/mol. Its IUPAC name is N-benzyl-1-[(2-chlorophenyl)methyl]-N-ethylpiperidin-1-ium-4-carboxamide.
| Compound Name | N-benzyl-1-[(2-chlorophenyl)methyl]-N-ethylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 7334890 |
| Molecular Formula | C22H28ClN2O+ |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | N-benzyl-1-[(2-chlorophenyl)methyl]-N-ethylpiperidin-1-ium-4-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)C1CC[NH+](Cc2ccccc2Cl)CC1 |
| InChI | InChI=1S/C22H27ClN2O/c1-2-25(16-18-8-4-3-5-9-18)22(26)19-12-14-24(15-13-19)17-20-10-6-7-11-21(20)23/h3-11,19H,2,12-17H2,1H3/p+1 |
| InChIKey | AMYVUKTZAGQPCX-UHFFFAOYSA-O |
| XLogP | 3.18 |
| TPSA | 24.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |