C26H37NO2Si — CID 132541746
(2S)-1-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-2-trimethylsilylhexan-1-one (PubChem CID 132541746) has the molecular formula C26H37NO2Si and a molecular weight of 423.67 g/mol. Its IUPAC name is (2S)-1-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-2-trimethylsilylhexan-1-one.
| Compound Name | (2S)-1-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-2-trimethylsilylhexan-1-one |
|---|---|
| PubChem CID | 132541746 |
| Molecular Formula | C26H37NO2Si |
| Molecular Weight | 423.67 g/mol |
| Exact Mass | 423.26 |
| IUPAC Name | (2S)-1-[(2S)-2-[hydroxy(diphenyl)methyl]pyrrolidin-1-yl]-2-trimethylsilylhexan-1-one |
| SMILES | CCCC[C@@H](C(=O)N1CCC[C@H]1C(O)(c1ccccc1)c1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C26H37NO2Si/c1-5-6-18-23(30(2,3)4)25(28)27-20-13-19-24(27)26(29,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17,23-24,29H,5-6,13,18-20H2,1-4H3/t23-,24-/m0/s1 |
| InChIKey | TXZFHCBXABWOIA-ZEQRLZLVSA-N |
| XLogP | 5.81 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.67 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|