About 2,7,9-trimethoxy-9H-fluorene
2,7,9-trimethoxy-9H-fluorene (PubChem CID 155898925) has the molecular formula C16H16O3
and a molecular weight of 256.30 g/mol. Its IUPAC name is 2,7,9-trimethoxy-9H-fluorene.
Molecular Properties
| Compound Name | 2,7,9-trimethoxy-9H-fluorene |
| PubChem CID | 155898925 |
| Molecular Formula | C16H16O3 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2,7,9-trimethoxy-9H-fluorene |
| SMILES | COc1ccc2c(c1)C(OC)c1cc(OC)ccc1-2 |
| InChI | InChI=1S/C16H16O3/c1-17-10-4-6-12-13-7-5-11(18-2)9-15(13)16(19-3)14(12)8-10/h4-9,16H,1-3H3 |
| InChIKey | CFJSUKQVZZUVJS-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,7,9-trimethoxy-9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7,9-trimethoxy-9H-fluorene?
The IUPAC name of 2,7,9-trimethoxy-9H-fluorene (CID 155898925) is 2,7,9-trimethoxy-9H-fluorene.
What is the SMILES notation for 2,7,9-trimethoxy-9H-fluorene?
The canonical SMILES for 2,7,9-trimethoxy-9H-fluorene is COc1ccc2c(c1)C(OC)c1cc(OC)ccc1-2.
What is the InChIKey of 2,7,9-trimethoxy-9H-fluorene?
The InChIKey is CFJSUKQVZZUVJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16O3/c1-17-10-4-6-12-13-7-5-11(18-2)9-15(13)16(19-3)14(12)8-10/h4-9,16H,1-3H3.
What are the key properties of 2,7,9-trimethoxy-9H-fluorene?
2,7,9-trimethoxy-9H-fluorene has a molecular weight of 256.30 g/mol, XLogP of 3.42, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7,9-trimethoxy-9H-fluorene is sourced from PubChem (CID 155898925), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).