C15H14O — CID 94034953
(1S,8R,9S,12S)-4-methoxytetracyclo[6.4.2.02,7.09,12]tetradeca-2(7),3,5,10,13-pentaene (PubChem CID 94034953) has the molecular formula C15H14O and a molecular weight of 210.28 g/mol. Its IUPAC name is (1S,8R,9S,12S)-4-methoxytetracyclo[6.4.2.02,7.09,12]tetradeca-2(7),3,5,10,13-pentaene.
| Compound Name | (1S,8R,9S,12S)-4-methoxytetracyclo[6.4.2.02,7.09,12]tetradeca-2(7),3,5,10,13-pentaene |
|---|---|
| PubChem CID | 94034953 |
| Molecular Formula | C15H14O |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.10 |
| IUPAC Name | (1S,8R,9S,12S)-4-methoxytetracyclo[6.4.2.02,7.09,12]tetradeca-2(7),3,5,10,13-pentaene |
| SMILES | COc1ccc2c(c1)[C@H]1C=C[C@@H]2[C@H]2C=C[C@@H]21 |
| InChI | InChI=1S/C15H14O/c1-16-9-2-3-13-11-6-7-14(15(13)8-9)12-5-4-10(11)12/h2-8,10-12,14H,1H3/t10-,11-,12+,14+/m1/s1 |
| InChIKey | OBFXLUZQOMFZHE-NMKXLXIOSA-N |
| XLogP | 3.25 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|