C13H17NO — CID 11542980
7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole (PubChem CID 11542980) has the molecular formula C13H17NO and a molecular weight of 203.28 g/mol. Its IUPAC name is 7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole.
| Compound Name | 7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 11542980 |
| Molecular Formula | C13H17NO |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.13 |
| IUPAC Name | 7-methoxy-4-methyl-1,2,3,3a,4,8b-hexahydroindeno[1,2-c]pyrrole |
| SMILES | COc1ccc2c(c1)C1CNCC1C2C |
| InChI | InChI=1S/C13H17NO/c1-8-10-4-3-9(15-2)5-11(10)13-7-14-6-12(8)13/h3-5,8,12-14H,6-7H2,1-2H3 |
| InChIKey | CUWZDAXKKWBGLQ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |