C19H21NO6 — CID 122376726
ethyl (1S,2aS,8bS)-1-(morpholine-4-carbonyl)-3-oxo-2,8b-dihydro-1H-cyclobuta[c]chromene-2a-carboxylate (PubChem CID 122376726) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is ethyl (1S,2aS,8bS)-1-(morpholine-4-carbonyl)-3-oxo-2,8b-dihydro-1H-cyclobuta[c]chromene-2a-carboxylate.
| Compound Name | ethyl (1S,2aS,8bS)-1-(morpholine-4-carbonyl)-3-oxo-2,8b-dihydro-1H-cyclobuta[c]chromene-2a-carboxylate |
|---|---|
| PubChem CID | 122376726 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | ethyl (1S,2aS,8bS)-1-(morpholine-4-carbonyl)-3-oxo-2,8b-dihydro-1H-cyclobuta[c]chromene-2a-carboxylate |
| SMILES | CCOC(=O)[C@]12C[C@H](C(=O)N3CCOCC3)[C@H]1c1ccccc1OC2=O |
| InChI | InChI=1S/C19H21NO6/c1-2-25-17(22)19-11-13(16(21)20-7-9-24-10-8-20)15(19)12-5-3-4-6-14(12)26-18(19)23/h3-6,13,15H,2,7-11H2,1H3/t13-,15+,19-/m0/s1 |
| InChIKey | BEYJYWLNKYEIRQ-OHNRDTAOSA-N |
| XLogP | 1.12 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|