C21H21NO2 — CID 819622
morpholin-4-yl-[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanone (PubChem CID 819622) has the molecular formula C21H21NO2 and a molecular weight of 319.40 g/mol. Its IUPAC name is morpholin-4-yl-[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanone.
| Compound Name | morpholin-4-yl-[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanone |
|---|---|
| PubChem CID | 819622 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | morpholin-4-yl-[(15R)-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,9,11,13-hexaenyl]methanone |
| SMILES | O=C([C@@H]1CC2c3ccccc3C1c1ccccc12)N1CCOCC1 |
| InChI | InChI=1S/C21H21NO2/c23-21(22-9-11-24-12-10-22)19-13-18-14-5-1-3-7-16(14)20(19)17-8-4-2-6-15(17)18/h1-8,18-20H,9-13H2/t18?,19-,20?/m1/s1 |
| InChIKey | OTACKTYTFTXBLR-IOJLRTSASA-N |
| XLogP | 3.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |