C25H25FO5 — CID 132595228
diethyl (3aR,4R,9bS)-7-fluoro-5-oxo-4-phenyl-3,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene-2,2-dicarboxylate (PubChem CID 132595228) has the molecular formula C25H25FO5 and a molecular weight of 424.47 g/mol. Its IUPAC name is diethyl (3aR,4R,9bS)-7-fluoro-5-oxo-4-phenyl-3,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene-2,2-dicarboxylate.
| Compound Name | diethyl (3aR,4R,9bS)-7-fluoro-5-oxo-4-phenyl-3,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 132595228 |
| Molecular Formula | C25H25FO5 |
| Molecular Weight | 424.47 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | diethyl (3aR,4R,9bS)-7-fluoro-5-oxo-4-phenyl-3,3a,4,9b-tetrahydro-1H-cyclopenta[a]naphthalene-2,2-dicarboxylate |
| SMILES | CCOC(=O)C1(C(=O)OCC)C[C@@H]2[C@H](C1)c1ccc(F)cc1C(=O)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H25FO5/c1-3-30-23(28)25(24(29)31-4-2)13-19-17-11-10-16(26)12-18(17)22(27)21(20(19)14-25)15-8-6-5-7-9-15/h5-12,19-21H,3-4,13-14H2,1-2H3/t19-,20-,21+/m1/s1 |
| InChIKey | DQIZTKBXVFGNTD-NJYVYQBISA-N |
| XLogP | 4.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.47 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|