C15H18O3 — CID 155882843
ethyl [(1R,4S)-2-methylidene-4-phenylcyclobutyl]methyl carbonate (PubChem CID 155882843) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is ethyl [(1R,4S)-2-methylidene-4-phenylcyclobutyl]methyl carbonate.
| Compound Name | ethyl [(1R,4S)-2-methylidene-4-phenylcyclobutyl]methyl carbonate |
|---|---|
| PubChem CID | 155882843 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | ethyl [(1R,4S)-2-methylidene-4-phenylcyclobutyl]methyl carbonate |
| SMILES | C=C1C[C@H](c2ccccc2)[C@H]1COC(=O)OCC |
| InChI | InChI=1S/C15H18O3/c1-3-17-15(16)18-10-14-11(2)9-13(14)12-7-5-4-6-8-12/h4-8,13-14H,2-3,9-10H2,1H3/t13-,14+/m1/s1 |
| InChIKey | LXNBGQUQRNJGPJ-KGLIPLIRSA-N |
| XLogP | 3.52 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|