C15H14 — CID 58426249
3-methyl-4a,10-dihydroanthracene (PubChem CID 58426249) has the molecular formula C15H14 and a molecular weight of 194.28 g/mol. Its IUPAC name is 3-methyl-4a,10-dihydroanthracene.
| Compound Name | 3-methyl-4a,10-dihydroanthracene |
|---|---|
| PubChem CID | 58426249 |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.11 |
| IUPAC Name | 3-methyl-4a,10-dihydroanthracene |
| SMILES | CC1=CC2Cc3ccccc3C=C2C=C1 |
| InChI | InChI=1S/C15H14/c1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11/h2-9,15H,10H2,1H3 |
| InChIKey | XOBIHSZYBNYUGX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |