C14H18N+ — CID 1427198
(9aR)-2,2-dimethyl-1,3,9,9a-tetrahydrobenzo[f]isoindol-2-ium (PubChem CID 1427198) has the molecular formula C14H18N+ and a molecular weight of 200.31 g/mol. Its IUPAC name is (9aR)-2,2-dimethyl-1,3,9,9a-tetrahydrobenzo[f]isoindol-2-ium.
| Compound Name | (9aR)-2,2-dimethyl-1,3,9,9a-tetrahydrobenzo[f]isoindol-2-ium |
|---|---|
| PubChem CID | 1427198 |
| Molecular Formula | C14H18N+ |
| Molecular Weight | 200.31 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | (9aR)-2,2-dimethyl-1,3,9,9a-tetrahydrobenzo[f]isoindol-2-ium |
| SMILES | C[N+]1(C)CC2=Cc3ccccc3C[C@H]2C1 |
| InChI | InChI=1S/C14H18N/c1-15(2)9-13-7-11-5-3-4-6-12(11)8-14(13)10-15/h3-7,14H,8-10H2,1-2H3/q+1/t14-/m0/s1 |
| InChIKey | TVBLXJWXSYHCKO-AWEZNQCLSA-N |
| XLogP | 2.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|