C22H28N+ — CID 7302217
(7aR)-9,9-dipropyl-7,7a,8,10-tetrahydronaphtho[1,2-f]isoindol-9-ium (PubChem CID 7302217) has the molecular formula C22H28N+ and a molecular weight of 306.47 g/mol. Its IUPAC name is (7aR)-9,9-dipropyl-7,7a,8,10-tetrahydronaphtho[1,2-f]isoindol-9-ium.
| Compound Name | (7aR)-9,9-dipropyl-7,7a,8,10-tetrahydronaphtho[1,2-f]isoindol-9-ium |
|---|---|
| PubChem CID | 7302217 |
| Molecular Formula | C22H28N+ |
| Molecular Weight | 306.47 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | (7aR)-9,9-dipropyl-7,7a,8,10-tetrahydronaphtho[1,2-f]isoindol-9-ium |
| SMILES | CCC[N+]1(CCC)CC2=Cc3c(ccc4ccccc34)C[C@H]2C1 |
| InChI | InChI=1S/C22H28N/c1-3-11-23(12-4-2)15-19-13-18-10-9-17-7-5-6-8-21(17)22(18)14-20(19)16-23/h5-10,14,19H,3-4,11-13,15-16H2,1-2H3/q+1/t19-/m0/s1 |
| InChIKey | CXWXYLLRVJKTJB-IBGZPJMESA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.47 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|