C20H18S — CID 18420554
2-(3H-cyclopenta[a]naphthalen-2-yl)-5-propylthiophene (PubChem CID 18420554) has the molecular formula C20H18S and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-(3H-cyclopenta[a]naphthalen-2-yl)-5-propylthiophene.
| Compound Name | 2-(3H-cyclopenta[a]naphthalen-2-yl)-5-propylthiophene |
|---|---|
| PubChem CID | 18420554 |
| Molecular Formula | C20H18S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 2-(3H-cyclopenta[a]naphthalen-2-yl)-5-propylthiophene |
| SMILES | CCCc1ccc(C2=Cc3c(ccc4ccccc34)C2)s1 |
| InChI | InChI=1S/C20H18S/c1-2-5-17-10-11-20(21-17)16-12-15-9-8-14-6-3-4-7-18(14)19(15)13-16/h3-4,6-11,13H,2,5,12H2,1H3 |
| InChIKey | HSGRMDFSYZEXIT-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |