C13H11Br — CID 130219629
2-bromo-2,3-dihydro-1H-cyclopenta[a]naphthalene (PubChem CID 130219629) has the molecular formula C13H11Br and a molecular weight of 247.13 g/mol. Its IUPAC name is 2-bromo-2,3-dihydro-1H-cyclopenta[a]naphthalene.
| Compound Name | 2-bromo-2,3-dihydro-1H-cyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 130219629 |
| Molecular Formula | C13H11Br |
| Molecular Weight | 247.13 g/mol |
| Exact Mass | 246.00 |
| IUPAC Name | 2-bromo-2,3-dihydro-1H-cyclopenta[a]naphthalene |
| SMILES | BrC1Cc2ccc3ccccc3c2C1 |
| InChI | InChI=1S/C13H11Br/c14-11-7-10-6-5-9-3-1-2-4-12(9)13(10)8-11/h1-6,11H,7-8H2 |
| InChIKey | WJVARJAGLOBXME-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.13 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|