C15H15N — CID 59694708
CID 59694708 (PubChem CID 59694708) has the molecular formula C15H15N and a molecular weight of 209.29 g/mol.
| Compound Name | CID 59694708 |
|---|---|
| PubChem CID | 59694708 |
| Molecular Formula | C15H15N |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | — |
| SMILES | [CH]CNC1Cc2ccc3ccccc3c2C1 |
| InChI | InChI=1S/C15H15N/c1-2-16-13-9-12-8-7-11-5-3-4-6-14(11)15(12)10-13/h1,3-8,13,16H,2,9-10H2 |
| InChIKey | PLFJPAQWMBOYNT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |