C19H18N2 — CID 104694147
N-(isoquinolin-5-ylmethyl)-2,3-dihydro-1H-inden-2-amine (PubChem CID 104694147) has the molecular formula C19H18N2 and a molecular weight of 274.37 g/mol. Its IUPAC name is N-(isoquinolin-5-ylmethyl)-2,3-dihydro-1H-inden-2-amine.
| Compound Name | N-(isoquinolin-5-ylmethyl)-2,3-dihydro-1H-inden-2-amine |
|---|---|
| PubChem CID | 104694147 |
| Molecular Formula | C19H18N2 |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | N-(isoquinolin-5-ylmethyl)-2,3-dihydro-1H-inden-2-amine |
| SMILES | c1ccc2c(c1)CC(NCc1cccc3cnccc13)C2 |
| InChI | InChI=1S/C19H18N2/c1-2-5-15-11-18(10-14(15)4-1)21-13-17-7-3-6-16-12-20-9-8-19(16)17/h1-9,12,18,21H,10-11,13H2 |
| InChIKey | PXDNXEQDIYAIKZ-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |