C13H14N2 — CID 58170897
N-(isoquinolin-5-ylmethyl)cyclopropanamine (PubChem CID 58170897) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is N-(isoquinolin-5-ylmethyl)cyclopropanamine.
| Compound Name | N-(isoquinolin-5-ylmethyl)cyclopropanamine |
|---|---|
| PubChem CID | 58170897 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | N-(isoquinolin-5-ylmethyl)cyclopropanamine |
| SMILES | c1cc(CNC2CC2)c2ccncc2c1 |
| InChI | InChI=1S/C13H14N2/c1-2-10-8-14-7-6-13(10)11(3-1)9-15-12-4-5-12/h1-3,6-8,12,15H,4-5,9H2 |
| InChIKey | FPJQAVPEIDQYHA-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |