C15H18N2 — CID 55119141
N-(isoquinolin-5-ylmethyl)cyclopentanamine (PubChem CID 55119141) has the molecular formula C15H18N2 and a molecular weight of 226.32 g/mol. Its IUPAC name is N-(isoquinolin-5-ylmethyl)cyclopentanamine.
| Compound Name | N-(isoquinolin-5-ylmethyl)cyclopentanamine |
|---|---|
| PubChem CID | 55119141 |
| Molecular Formula | C15H18N2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | N-(isoquinolin-5-ylmethyl)cyclopentanamine |
| SMILES | c1cc(CNC2CCCC2)c2ccncc2c1 |
| InChI | InChI=1S/C15H18N2/c1-2-7-14(6-1)17-11-13-5-3-4-12-10-16-9-8-15(12)13/h3-5,8-10,14,17H,1-2,6-7,11H2 |
| InChIKey | NMNGZGJRLANHRW-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |