About 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium
2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium (PubChem CID 147176999) has the molecular formula C11H14NO+
and a molecular weight of 176.24 g/mol. Its IUPAC name is 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium.
Molecular Properties
| Compound Name | 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium |
| PubChem CID | 147176999 |
| Molecular Formula | C11H14NO+ |
| Molecular Weight | 176.24 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium |
| SMILES | C[N+]1(O)CC=Cc2ccccc2C1 |
| InChI | InChI=1S/C11H14NO/c1-12(13)8-4-7-10-5-2-3-6-11(10)9-12/h2-7,13H,8-9H2,1H3/q+1 |
| InChIKey | HFJRFZHJPPZFPY-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium?
The IUPAC name of 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium (CID 147176999) is 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium.
What is the SMILES notation for 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium?
The canonical SMILES for 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium is C[N+]1(O)CC=Cc2ccccc2C1.
What is the InChIKey of 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium?
The InChIKey is HFJRFZHJPPZFPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14NO/c1-12(13)8-4-7-10-5-2-3-6-11(10)9-12/h2-7,13H,8-9H2,1H3/q+1.
What are the key properties of 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium?
2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium has a molecular weight of 176.24 g/mol, XLogP of 2.05, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-2-methyl-1,3-dihydro-2-benzazepin-2-ium is sourced from PubChem (CID 147176999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).