About 2-methyl-1,3-dihydro-2-benzazepine
2-methyl-1,3-dihydro-2-benzazepine (PubChem CID 10898976) has the molecular formula C11H13N
and a molecular weight of 159.23 g/mol. Its IUPAC name is 2-methyl-1,3-dihydro-2-benzazepine.
Molecular Properties
| Compound Name | 2-methyl-1,3-dihydro-2-benzazepine |
| PubChem CID | 10898976 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 2-methyl-1,3-dihydro-2-benzazepine |
| SMILES | CN1CC=Cc2ccccc2C1 |
| InChI | InChI=1S/C11H13N/c1-12-8-4-7-10-5-2-3-6-11(10)9-12/h2-7H,8-9H2,1H3 |
| InChIKey | LRWBGELCQCQXHY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methyl-1,3-dihydro-2-benzazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1,3-dihydro-2-benzazepine?
The IUPAC name of 2-methyl-1,3-dihydro-2-benzazepine (CID 10898976) is 2-methyl-1,3-dihydro-2-benzazepine.
What is the SMILES notation for 2-methyl-1,3-dihydro-2-benzazepine?
The canonical SMILES for 2-methyl-1,3-dihydro-2-benzazepine is CN1CC=Cc2ccccc2C1.
What is the InChIKey of 2-methyl-1,3-dihydro-2-benzazepine?
The InChIKey is LRWBGELCQCQXHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N/c1-12-8-4-7-10-5-2-3-6-11(10)9-12/h2-7H,8-9H2,1H3.
What are the key properties of 2-methyl-1,3-dihydro-2-benzazepine?
2-methyl-1,3-dihydro-2-benzazepine has a molecular weight of 159.23 g/mol, XLogP of 2.15, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1,3-dihydro-2-benzazepine is sourced from PubChem (CID 10898976), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).