C11H12ClN — CID 101083787
4-chloro-2-methyl-1,3-dihydro-2-benzazepine (PubChem CID 101083787) has the molecular formula C11H12ClN and a molecular weight of 193.68 g/mol. Its IUPAC name is 4-chloro-2-methyl-1,3-dihydro-2-benzazepine.
| Compound Name | 4-chloro-2-methyl-1,3-dihydro-2-benzazepine |
|---|---|
| PubChem CID | 101083787 |
| Molecular Formula | C11H12ClN |
| Molecular Weight | 193.68 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 4-chloro-2-methyl-1,3-dihydro-2-benzazepine |
| SMILES | CN1CC(Cl)=Cc2ccccc2C1 |
| InChI | InChI=1S/C11H12ClN/c1-13-7-10-5-3-2-4-9(10)6-11(12)8-13/h2-6H,7-8H2,1H3 |
| InChIKey | VJTMPRRNILKUER-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.68 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |