C13H16N2O2 — CID 71063725
N-(2-hydroxyethyl)-2-methyl-1H-isoquinoline-3-carboxamide (PubChem CID 71063725) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2-methyl-1H-isoquinoline-3-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-2-methyl-1H-isoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 71063725 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-(2-hydroxyethyl)-2-methyl-1H-isoquinoline-3-carboxamide |
| SMILES | CN1Cc2ccccc2C=C1C(=O)NCCO |
| InChI | InChI=1S/C13H16N2O2/c1-15-9-11-5-3-2-4-10(11)8-12(15)13(17)14-6-7-16/h2-5,8,16H,6-7,9H2,1H3,(H,14,17) |
| InChIKey | WOPRHPORSCOWBA-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |