C11H13NS — CID 59272603
2-methyl-3-methylidene-1H-3λ4,2-benzothiazepine (PubChem CID 59272603) has the molecular formula C11H13NS and a molecular weight of 191.30 g/mol. Its IUPAC name is 2-methyl-3-methylidene-1H-3λ4,2-benzothiazepine.
| Compound Name | 2-methyl-3-methylidene-1H-3λ4,2-benzothiazepine |
|---|---|
| PubChem CID | 59272603 |
| Molecular Formula | C11H13NS |
| Molecular Weight | 191.30 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 2-methyl-3-methylidene-1H-3λ4,2-benzothiazepine |
| SMILES | C=S1C=Cc2ccccc2CN1C |
| InChI | InChI=1S/C11H13NS/c1-12-9-11-6-4-3-5-10(11)7-8-13(12)2/h3-8H,2,9H2,1H3 |
| InChIKey | LSZJFHBJWWDLTQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.30 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|