About ethane;2-propan-2-yl-1H-isoquinoline;yttrium
ethane;2-propan-2-yl-1H-isoquinoline;yttrium (PubChem CID 160548203) has the molecular formula C14H21NY
and a molecular weight of 292.24 g/mol. Its IUPAC name is ethane;2-propan-2-yl-1H-isoquinoline;yttrium.
Molecular Properties
| Compound Name | ethane;2-propan-2-yl-1H-isoquinoline;yttrium |
| PubChem CID | 160548203 |
| Molecular Formula | C14H21NY |
| Molecular Weight | 292.24 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | ethane;2-propan-2-yl-1H-isoquinoline;yttrium |
| SMILES | CC.CC(C)N1C=Cc2ccccc2C1.[Y] |
| InChI | InChI=1S/C12H15N.C2H6.Y/c1-10(2)13-8-7-11-5-3-4-6-12(11)9-13;1-2;/h3-8,10H,9H2,1-2H3;1-2H3; |
| InChIKey | QXSBKBXDLKXHGR-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.24 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2-propan-2-yl-1H-isoquinoline;yttrium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-propan-2-yl-1H-isoquinoline;yttrium?
The IUPAC name of ethane;2-propan-2-yl-1H-isoquinoline;yttrium (CID 160548203) is ethane;2-propan-2-yl-1H-isoquinoline;yttrium.
What is the SMILES notation for ethane;2-propan-2-yl-1H-isoquinoline;yttrium?
The canonical SMILES for ethane;2-propan-2-yl-1H-isoquinoline;yttrium is CC.CC(C)N1C=Cc2ccccc2C1.[Y].
What is the InChIKey of ethane;2-propan-2-yl-1H-isoquinoline;yttrium?
The InChIKey is QXSBKBXDLKXHGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C2H6.Y/c1-10(2)13-8-7-11-5-3-4-6-12(11)9-13;1-2;/h3-8,10H,9H2,1-2H3;1-2H3;.
What are the key properties of ethane;2-propan-2-yl-1H-isoquinoline;yttrium?
ethane;2-propan-2-yl-1H-isoquinoline;yttrium has a molecular weight of 292.24 g/mol, XLogP of 3.90, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-propan-2-yl-1H-isoquinoline;yttrium is sourced from PubChem (CID 160548203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).