About 1-methyl-2H-quinoline;hydrate;dihydroiodide
1-methyl-2H-quinoline;hydrate;dihydroiodide (PubChem CID 174675157) has the molecular formula C10H15I2NO
and a molecular weight of 419.04 g/mol. Its IUPAC name is 1-methyl-2H-quinoline;hydrate;dihydroiodide.
Molecular Properties
| Compound Name | 1-methyl-2H-quinoline;hydrate;dihydroiodide |
| PubChem CID | 174675157 |
| Molecular Formula | C10H15I2NO |
| Molecular Weight | 419.04 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | 1-methyl-2H-quinoline;hydrate;dihydroiodide |
| SMILES | CN1CC=Cc2ccccc21.I.I.O |
| InChI | InChI=1S/C10H11N.2HI.H2O/c1-11-8-4-6-9-5-2-3-7-10(9)11;;;/h2-7H,8H2,1H3;2*1H;1H2 |
| InChIKey | IMXDQOLMQQKAIN-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.04 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-methyl-2H-quinoline;hydrate;dihydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-2H-quinoline;hydrate;dihydroiodide?
The IUPAC name of 1-methyl-2H-quinoline;hydrate;dihydroiodide (CID 174675157) is 1-methyl-2H-quinoline;hydrate;dihydroiodide.
What is the SMILES notation for 1-methyl-2H-quinoline;hydrate;dihydroiodide?
The canonical SMILES for 1-methyl-2H-quinoline;hydrate;dihydroiodide is CN1CC=Cc2ccccc21.I.I.O.
What is the InChIKey of 1-methyl-2H-quinoline;hydrate;dihydroiodide?
The InChIKey is IMXDQOLMQQKAIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.2HI.H2O/c1-11-8-4-6-9-5-2-3-7-10(9)11;;;/h2-7H,8H2,1H3;2*1H;1H2.
What are the key properties of 1-methyl-2H-quinoline;hydrate;dihydroiodide?
1-methyl-2H-quinoline;hydrate;dihydroiodide has a molecular weight of 419.04 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-2H-quinoline;hydrate;dihydroiodide is sourced from PubChem (CID 174675157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).