About iridium;1-pentyl-2H-quinoline
iridium;1-pentyl-2H-quinoline (PubChem CID 157228935) has the molecular formula C14H19IrN
and a molecular weight of 393.53 g/mol. Its IUPAC name is iridium;1-pentyl-2H-quinoline.
Molecular Properties
| Compound Name | iridium;1-pentyl-2H-quinoline |
| PubChem CID | 157228935 |
| Molecular Formula | C14H19IrN |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 394.11 |
| IUPAC Name | iridium;1-pentyl-2H-quinoline |
| SMILES | CCCCCN1CC=Cc2ccccc21.[Ir] |
| InChI | InChI=1S/C14H19N.Ir/c1-2-3-6-11-15-12-7-9-13-8-4-5-10-14(13)15;/h4-5,7-10H,2-3,6,11-12H2,1H3; |
| InChIKey | ATWNIBNPYBGIQH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze iridium;1-pentyl-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iridium;1-pentyl-2H-quinoline?
The IUPAC name of iridium;1-pentyl-2H-quinoline (CID 157228935) is iridium;1-pentyl-2H-quinoline.
What is the SMILES notation for iridium;1-pentyl-2H-quinoline?
The canonical SMILES for iridium;1-pentyl-2H-quinoline is CCCCCN1CC=Cc2ccccc21.[Ir].
What is the InChIKey of iridium;1-pentyl-2H-quinoline?
The InChIKey is ATWNIBNPYBGIQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N.Ir/c1-2-3-6-11-15-12-7-9-13-8-4-5-10-14(13)15;/h4-5,7-10H,2-3,6,11-12H2,1H3;.
What are the key properties of iridium;1-pentyl-2H-quinoline?
iridium;1-pentyl-2H-quinoline has a molecular weight of 393.53 g/mol, XLogP of 3.71, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iridium;1-pentyl-2H-quinoline is sourced from PubChem (CID 157228935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).