About hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone
hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone (PubChem CID 175158866) has the molecular formula C17H15F6NOSb-
and a molecular weight of 485.06 g/mol. Its IUPAC name is hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone.
Molecular Properties
| Compound Name | hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone |
| PubChem CID | 175158866 |
| Molecular Formula | C17H15F6NOSb- |
| Molecular Weight | 485.06 g/mol |
| Exact Mass | 484.01 |
| IUPAC Name | hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone |
| SMILES | F[Sb-](F)(F)(F)(F)F.O=C(CN1CC=Cc2ccccc21)c1ccccc1 |
| InChI | InChI=1S/C17H15NO.6FH.Sb/c19-17(15-8-2-1-3-9-15)13-18-12-6-10-14-7-4-5-11-16(14)18;;;;;;;/h1-11H,12-13H2;6*1H;/q;;;;;;;+5/p-6 |
| InChIKey | LTOVMJXTAJHMBA-UHFFFAOYSA-H |
| XLogP | 5.54 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 485.06 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone?
The IUPAC name of hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone (CID 175158866) is hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone.
What is the SMILES notation for hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone?
The canonical SMILES for hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone is F[Sb-](F)(F)(F)(F)F.O=C(CN1CC=Cc2ccccc21)c1ccccc1.
What is the InChIKey of hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone?
The InChIKey is LTOVMJXTAJHMBA-UHFFFAOYSA-H. The full InChI is InChI=1S/C17H15NO.6FH.Sb/c19-17(15-8-2-1-3-9-15)13-18-12-6-10-14-7-4-5-11-16(14)18;;;;;;;/h1-11H,12-13H2;6*1H;/q;;;;;;;+5/p-6.
What are the key properties of hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone?
hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone has a molecular weight of 485.06 g/mol, XLogP of 5.54, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexafluoroantimony(1-);1-phenyl-2-(2H-quinolin-1-yl)ethanone is sourced from PubChem (CID 175158866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).