C22H32N4O2 — CID 11338105
11,25-dimethyl-5,18-dioxa-2,8,15,21-tetrazatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene (PubChem CID 11338105) has the molecular formula C22H32N4O2 and a molecular weight of 384.52 g/mol. Its IUPAC name is 11,25-dimethyl-5,18-dioxa-2,8,15,21-tetrazatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene.
| Compound Name | 11,25-dimethyl-5,18-dioxa-2,8,15,21-tetrazatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene |
|---|---|
| PubChem CID | 11338105 |
| Molecular Formula | C22H32N4O2 |
| Molecular Weight | 384.52 g/mol |
| Exact Mass | 384.25 |
| IUPAC Name | 11,25-dimethyl-5,18-dioxa-2,8,15,21-tetrazatricyclo[20.4.0.09,14]hexacosa-1(22),9(14),10,12,23,25-hexaene |
| SMILES | Cc1ccc2c(c1)NCCOCCNc1cc(C)ccc1NCCOCCN2 |
| InChI | InChI=1S/C22H32N4O2/c1-17-3-5-19-21(15-17)25-9-13-28-14-10-26-22-16-18(2)4-6-20(22)24-8-12-27-11-7-23-19/h3-6,15-16,23-26H,7-14H2,1-2H3 |
| InChIKey | GJYWUPCKGJUQRB-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 66.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.52 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |