C28H40N4O2 — CID 177439207
(9E,24E)-10,13,25,28-tetramethyl-8,23-dioxa-2,9,17,24-tetrazatricyclo[24.4.0.011,16]triaconta-1(26),9,11(16),12,14,24,27,29-octaene (PubChem CID 177439207) has the molecular formula C28H40N4O2 and a molecular weight of 464.65 g/mol. Its IUPAC name is (9E,24E)-10,13,25,28-tetramethyl-8,23-dioxa-2,9,17,24-tetrazatricyclo[24.4.0.011,16]triaconta-1(26),9,11(16),12,14,24,27,29-octaene.
| Compound Name | (9E,24E)-10,13,25,28-tetramethyl-8,23-dioxa-2,9,17,24-tetrazatricyclo[24.4.0.011,16]triaconta-1(26),9,11(16),12,14,24,27,29-octaene |
|---|---|
| PubChem CID | 177439207 |
| Molecular Formula | C28H40N4O2 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.32 |
| IUPAC Name | (9E,24E)-10,13,25,28-tetramethyl-8,23-dioxa-2,9,17,24-tetrazatricyclo[24.4.0.011,16]triaconta-1(26),9,11(16),12,14,24,27,29-octaene |
| SMILES | C/C1=N\OCCCCCNc2ccc(C)cc2/C(C)=N/OCCCCCNc2ccc(C)cc21 |
| InChI | InChI=1S/C28H40N4O2/c1-21-11-13-27-25(19-21)23(3)31-33-17-9-6-8-16-30-28-14-12-22(2)20-26(28)24(4)32-34-18-10-5-7-15-29-27/h11-14,19-20,29-30H,5-10,15-18H2,1-4H3/b31-23+,32-24+ |
| InChIKey | NOFPKQAGLCMNAU-QBRCKEFASA-N |
| XLogP | 6.66 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |