C26H36N4O2 — CID 177394025
(9E,24E)-10,25-dimethyl-8,23-dioxa-2,9,17,24-tetrazatricyclo[24.4.0.011,16]triaconta-1(30),9,11,13,15,24,26,28-octaene (PubChem CID 177394025) has the molecular formula C26H36N4O2 and a molecular weight of 436.60 g/mol. Its IUPAC name is (9E,24E)-10,25-dimethyl-8,23-dioxa-2,9,17,24-tetrazatricyclo[24.4.0.011,16]triaconta-1(30),9,11,13,15,24,26,28-octaene.
| Compound Name | (9E,24E)-10,25-dimethyl-8,23-dioxa-2,9,17,24-tetrazatricyclo[24.4.0.011,16]triaconta-1(30),9,11,13,15,24,26,28-octaene |
|---|---|
| PubChem CID | 177394025 |
| Molecular Formula | C26H36N4O2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.28 |
| IUPAC Name | (9E,24E)-10,25-dimethyl-8,23-dioxa-2,9,17,24-tetrazatricyclo[24.4.0.011,16]triaconta-1(30),9,11,13,15,24,26,28-octaene |
| SMILES | C/C1=N\OCCCCCNc2ccccc2/C(C)=N/OCCCCCNc2ccccc21 |
| InChI | InChI=1S/C26H36N4O2/c1-21-23-13-5-7-15-25(23)27-17-9-4-12-20-32-30-22(2)24-14-6-8-16-26(24)28-18-10-3-11-19-31-29-21/h5-8,13-16,27-28H,3-4,9-12,17-20H2,1-2H3/b29-21+,30-22+ |
| InChIKey | FBXNZFRXIXPPFH-VFIVCBTMSA-N |
| XLogP | 6.05 |
| TPSA | 67.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |