C11H10N2S — CID 96619257
5,6-dihydro-4H-[1,3]thiazolo[5,4-d][1]benzazepine (PubChem CID 96619257) has the molecular formula C11H10N2S and a molecular weight of 202.28 g/mol. Its IUPAC name is 5,6-dihydro-4H-[1,3]thiazolo[5,4-d][1]benzazepine.
| Compound Name | 5,6-dihydro-4H-[1,3]thiazolo[5,4-d][1]benzazepine |
|---|---|
| PubChem CID | 96619257 |
| Molecular Formula | C11H10N2S |
| Molecular Weight | 202.28 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | 5,6-dihydro-4H-[1,3]thiazolo[5,4-d][1]benzazepine |
| SMILES | c1ccc2c(c1)NCCc1scnc1-2 |
| InChI | InChI=1S/C11H10N2S/c1-2-4-9-8(3-1)11-10(5-6-12-9)14-7-13-11/h1-4,7,12H,5-6H2 |
| InChIKey | MZXOAULVGZXPGI-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |