C14H14ClN3S — CID 10039937
13-thia-8,18-diaza-16-azoniatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2,4,6,12(16),17-hexaene chloride (PubChem CID 10039937) has the molecular formula C14H14ClN3S and a molecular weight of 291.81 g/mol. Its IUPAC name is 13-thia-8,18-diaza-16-azoniatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2,4,6,12(16),17-hexaene chloride.
| Compound Name | 13-thia-8,18-diaza-16-azoniatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2,4,6,12(16),17-hexaene chloride |
|---|---|
| PubChem CID | 10039937 |
| Molecular Formula | C14H14ClN3S |
| Molecular Weight | 291.81 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 13-thia-8,18-diaza-16-azoniatetracyclo[9.7.0.02,7.012,16]octadeca-1(11),2,4,6,12(16),17-hexaene chloride |
| SMILES | [Cl-].c1ccc2c(c1)NCCc1c-2nc[n+]2c1SCC2 |
| InChI | InChI=1S/C14H13N3S.ClH/c1-2-4-12-10(3-1)13-11(5-6-15-12)14-17(9-16-13)7-8-18-14;/h1-4,9H,5-8H2;1H |
| InChIKey | OQDRROUTJKCTBJ-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 28.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.81 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|