C13H13N3O — CID 116698410
4-(3-methoxypyrazin-2-yl)-2,3-dihydro-1H-indole (PubChem CID 116698410) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is 4-(3-methoxypyrazin-2-yl)-2,3-dihydro-1H-indole.
| Compound Name | 4-(3-methoxypyrazin-2-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116698410 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(3-methoxypyrazin-2-yl)-2,3-dihydro-1H-indole |
| SMILES | COc1nccnc1-c1cccc2c1CCN2 |
| InChI | InChI=1S/C13H13N3O/c1-17-13-12(15-7-8-16-13)10-3-2-4-11-9(10)5-6-14-11/h2-4,7-8,14H,5-6H2,1H3 |
| InChIKey | UTAIEGNXEZVZKT-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |