C12H18O — CID 143262854
ethane;6-methyl-3,4-dihydro-1H-isochromene (PubChem CID 143262854) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is ethane;6-methyl-3,4-dihydro-1H-isochromene.
| Compound Name | ethane;6-methyl-3,4-dihydro-1H-isochromene |
|---|---|
| PubChem CID | 143262854 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | ethane;6-methyl-3,4-dihydro-1H-isochromene |
| SMILES | CC.Cc1ccc2c(c1)CCOC2 |
| InChI | InChI=1S/C10H12O.C2H6/c1-8-2-3-10-7-11-5-4-9(10)6-8;1-2/h2-3,6H,4-5,7H2,1H3;1-2H3 |
| InChIKey | WCEMLKJYBQFQPV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |