C14H19NO — CID 175887953
1-(3,4-dihydro-1H-isochromen-6-yl)piperidine (PubChem CID 175887953) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is 1-(3,4-dihydro-1H-isochromen-6-yl)piperidine.
| Compound Name | 1-(3,4-dihydro-1H-isochromen-6-yl)piperidine |
|---|---|
| PubChem CID | 175887953 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | 1-(3,4-dihydro-1H-isochromen-6-yl)piperidine |
| SMILES | c1cc2c(cc1N1CCCCC1)CCOC2 |
| InChI | InChI=1S/C14H19NO/c1-2-7-15(8-3-1)14-5-4-13-11-16-9-6-12(13)10-14/h4-5,10H,1-3,6-9,11H2 |
| InChIKey | KIXJEVTWDGJHCB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|