C16H30O — CID 145162253
ethane;5-methyl-2,3-dihydro-1-benzofuran;propane (PubChem CID 145162253) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is ethane;5-methyl-2,3-dihydro-1-benzofuran;propane.
| Compound Name | ethane;5-methyl-2,3-dihydro-1-benzofuran;propane |
|---|---|
| PubChem CID | 145162253 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | ethane;5-methyl-2,3-dihydro-1-benzofuran;propane |
| SMILES | CC.CC.CCC.Cc1ccc2c(c1)CCO2 |
| InChI | InChI=1S/C9H10O.C3H8.2C2H6/c1-7-2-3-9-8(6-7)4-5-10-9;1-3-2;2*1-2/h2-3,6H,4-5H2,1H3;3H2,1-2H3;2*1-2H3 |
| InChIKey | WPCXERGMVAXCAE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |