C17H19NO2 — CID 65430830
2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-5-methylaniline (PubChem CID 65430830) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-5-methylaniline.
| Compound Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-5-methylaniline |
|---|---|
| PubChem CID | 65430830 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 2-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-5-methylaniline |
| SMILES | Cc1ccc(OCCc2ccc3c(c2)CCO3)c(N)c1 |
| InChI | InChI=1S/C17H19NO2/c1-12-2-4-17(15(18)10-12)20-8-6-13-3-5-16-14(11-13)7-9-19-16/h2-5,10-11H,6-9,18H2,1H3 |
| InChIKey | ZJSHXVVULZZHHC-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|