C17H15FO3 — CID 102670873
4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-fluorobenzaldehyde (PubChem CID 102670873) has the molecular formula C17H15FO3 and a molecular weight of 286.30 g/mol. Its IUPAC name is 4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-fluorobenzaldehyde.
| Compound Name | 4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-fluorobenzaldehyde |
|---|---|
| PubChem CID | 102670873 |
| Molecular Formula | C17H15FO3 |
| Molecular Weight | 286.30 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 4-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-3-fluorobenzaldehyde |
| SMILES | O=Cc1ccc(OCCc2ccc3c(c2)CCO3)c(F)c1 |
| InChI | InChI=1S/C17H15FO3/c18-15-10-13(11-19)2-4-17(15)21-7-5-12-1-3-16-14(9-12)6-8-20-16/h1-4,9-11H,5-8H2 |
| InChIKey | DBSXJWCKNGMDEG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|