C15H14FNO2 — CID 113296520
5-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-2-fluoropyridine (PubChem CID 113296520) has the molecular formula C15H14FNO2 and a molecular weight of 259.28 g/mol. Its IUPAC name is 5-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-2-fluoropyridine.
| Compound Name | 5-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-2-fluoropyridine |
|---|---|
| PubChem CID | 113296520 |
| Molecular Formula | C15H14FNO2 |
| Molecular Weight | 259.28 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 5-[2-(2,3-dihydro-1-benzofuran-5-yl)ethoxy]-2-fluoropyridine |
| SMILES | Fc1ccc(OCCc2ccc3c(c2)CCO3)cn1 |
| InChI | InChI=1S/C15H14FNO2/c16-15-4-2-13(10-17-15)18-7-5-11-1-3-14-12(9-11)6-8-19-14/h1-4,9-10H,5-8H2 |
| InChIKey | ZDZYWIQPTWYDMT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.28 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|