C16H13BrF2O2 — CID 107098626
5-[2-(5-bromo-2,3-difluorophenoxy)ethyl]-2,3-dihydro-1-benzofuran (PubChem CID 107098626) has the molecular formula C16H13BrF2O2 and a molecular weight of 355.18 g/mol. Its IUPAC name is 5-[2-(5-bromo-2,3-difluorophenoxy)ethyl]-2,3-dihydro-1-benzofuran.
| Compound Name | 5-[2-(5-bromo-2,3-difluorophenoxy)ethyl]-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 107098626 |
| Molecular Formula | C16H13BrF2O2 |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 354.01 |
| IUPAC Name | 5-[2-(5-bromo-2,3-difluorophenoxy)ethyl]-2,3-dihydro-1-benzofuran |
| SMILES | Fc1cc(Br)cc(OCCc2ccc3c(c2)CCO3)c1F |
| InChI | InChI=1S/C16H13BrF2O2/c17-12-8-13(18)16(19)15(9-12)21-5-3-10-1-2-14-11(7-10)4-6-20-14/h1-2,7-9H,3-6H2 |
| InChIKey | DUOZJHGOKUKSIL-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|