C15H14O3S — CID 23543562
5-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzofuran (PubChem CID 23543562) has the molecular formula C15H14O3S and a molecular weight of 274.34 g/mol. Its IUPAC name is 5-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 23543562 |
| Molecular Formula | C15H14O3S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 5-(4-methylphenyl)sulfonyl-2,3-dihydro-1-benzofuran |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc3c(c2)CCO3)cc1 |
| InChI | InChI=1S/C15H14O3S/c1-11-2-4-13(5-3-11)19(16,17)14-6-7-15-12(10-14)8-9-18-15/h2-7,10H,8-9H2,1H3 |
| InChIKey | OYBPZKNMYQBKQK-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |