C18H17F3O4S — CID 102436964
[2-(2,3-dihydro-1-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate (PubChem CID 102436964) has the molecular formula C18H17F3O4S and a molecular weight of 386.39 g/mol. Its IUPAC name is [2-(2,3-dihydro-1-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-(2,3-dihydro-1-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102436964 |
| Molecular Formula | C18H17F3O4S |
| Molecular Weight | 386.39 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | [2-(2,3-dihydro-1-benzofuran-5-yl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC(C)(c2ccc3c(c2)CCO3)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H17F3O4S/c1-12-3-6-15(7-4-12)26(22,23)25-17(2,18(19,20)21)14-5-8-16-13(11-14)9-10-24-16/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | UOYSDBXGHHZBPA-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|