C18H16F3NO4S — CID 102436973
[2-(3-cyano-4-methoxyphenyl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate (PubChem CID 102436973) has the molecular formula C18H16F3NO4S and a molecular weight of 399.39 g/mol. Its IUPAC name is [2-(3-cyano-4-methoxyphenyl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate.
| Compound Name | [2-(3-cyano-4-methoxyphenyl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 102436973 |
| Molecular Formula | C18H16F3NO4S |
| Molecular Weight | 399.39 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [2-(3-cyano-4-methoxyphenyl)-1,1,1-trifluoropropan-2-yl] 4-methylbenzenesulfonate |
| SMILES | COc1ccc(C(C)(OS(=O)(=O)c2ccc(C)cc2)C(F)(F)F)cc1C#N |
| InChI | InChI=1S/C18H16F3NO4S/c1-12-4-7-15(8-5-12)27(23,24)26-17(2,18(19,20)21)14-6-9-16(25-3)13(10-14)11-22/h4-10H,1-3H3 |
| InChIKey | RHHXDUIQPIXXKG-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.39 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|