C23H22INO6S — CID 171772504
[(2-cyanophenyl)-(2,4,6-trimethoxyphenyl)-λ3-iodanyl] 4-methylbenzenesulfonate (PubChem CID 171772504) has the molecular formula C23H22INO6S and a molecular weight of 567.40 g/mol. Its IUPAC name is [(2-cyanophenyl)-(2,4,6-trimethoxyphenyl)-λ3-iodanyl] 4-methylbenzenesulfonate.
| Compound Name | [(2-cyanophenyl)-(2,4,6-trimethoxyphenyl)-λ3-iodanyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 171772504 |
| Molecular Formula | C23H22INO6S |
| Molecular Weight | 567.40 g/mol |
| Exact Mass | 567.02 |
| IUPAC Name | [(2-cyanophenyl)-(2,4,6-trimethoxyphenyl)-λ3-iodanyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(OC)c(I(OS(=O)(=O)c2ccc(C)cc2)c2ccccc2C#N)c(OC)c1 |
| InChI | InChI=1S/C23H22INO6S/c1-16-9-11-19(12-10-16)32(26,27)31-24(20-8-6-5-7-17(20)15-25)23-21(29-3)13-18(28-2)14-22(23)30-4/h5-14H,1-4H3 |
| InChIKey | OFRXYSLHTGHSRB-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 94.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|