About manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane
manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane (PubChem CID 159257789) has the molecular formula C12H26MnN4+2
and a molecular weight of 281.31 g/mol. Its IUPAC name is manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane.
Molecular Properties
| Compound Name | manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane |
| PubChem CID | 159257789 |
| Molecular Formula | C12H26MnN4+2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane |
| SMILES | C1CNCCN2CCCNCCN(C1)CC2.[Mn+2] |
| InChI | InChI=1S/C12H26N4.Mn/c1-3-13-5-10-16-8-2-4-14-6-9-15(7-1)11-12-16;/h13-14H,1-12H2;/q;+2 |
| InChIKey | KWCUYELONNYTTQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane?
The IUPAC name of manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane (CID 159257789) is manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane.
What is the SMILES notation for manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane?
The canonical SMILES for manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane is C1CNCCN2CCCNCCN(C1)CC2.[Mn+2].
What is the InChIKey of manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane?
The InChIKey is KWCUYELONNYTTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N4.Mn/c1-3-13-5-10-16-8-2-4-14-6-9-15(7-1)11-12-16;/h13-14H,1-12H2;/q;+2.
What are the key properties of manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane?
manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane has a molecular weight of 281.31 g/mol, XLogP of -0.43, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane is sourced from PubChem (CID 159257789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).