C12H26MnN4+2 — CID 159257789
manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane (PubChem CID 159257789) has the molecular formula C12H26MnN4+2 and a molecular weight of 281.31 g/mol. Its IUPAC name is manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane.
| Compound Name | manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane |
|---|---|
| PubChem CID | 159257789 |
| Molecular Formula | C12H26MnN4+2 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.15 |
| IUPAC Name | manganese(2+);1,4,8,11-tetrazabicyclo[6.6.2]hexadecane |
| SMILES | C1CNCCN2CCCNCCN(C1)CC2.[Mn+2] |
| InChI | InChI=1S/C12H26N4.Mn/c1-3-13-5-10-16-8-2-4-14-6-9-15(7-1)11-12-16;/h13-14H,1-12H2;/q;+2 |
| InChIKey | KWCUYELONNYTTQ-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |