C17H38N4 — CID 158347014
1-tert-butyl-1,4-diazepane;1-tert-butylpiperazine (PubChem CID 158347014) has the molecular formula C17H38N4 and a molecular weight of 298.52 g/mol. Its IUPAC name is 1-tert-butyl-1,4-diazepane;1-tert-butylpiperazine.
| Compound Name | 1-tert-butyl-1,4-diazepane;1-tert-butylpiperazine |
|---|---|
| PubChem CID | 158347014 |
| Molecular Formula | C17H38N4 |
| Molecular Weight | 298.52 g/mol |
| Exact Mass | 298.31 |
| IUPAC Name | 1-tert-butyl-1,4-diazepane;1-tert-butylpiperazine |
| SMILES | CC(C)(C)N1CCCNCC1.CC(C)(C)N1CCNCC1 |
| InChI | InChI=1S/C9H20N2.C8H18N2/c1-9(2,3)11-7-4-5-10-6-8-11;1-8(2,3)10-6-4-9-5-7-10/h10H,4-8H2,1-3H3;9H,4-7H2,1-3H3 |
| InChIKey | GRVXBHDAFJZYMU-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 30.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |