C34H52N8O — CID 102503341
39-oxa-1,4,11,14,17,24,29,36-octazapentacyclo[12.12.12.26,9.219,22.131,34]tritetraconta-6,8,19(41),20,22(40),31,33,42-octaene (PubChem CID 102503341) has the molecular formula C34H52N8O and a molecular weight of 588.85 g/mol. Its IUPAC name is 39-oxa-1,4,11,14,17,24,29,36-octazapentacyclo[12.12.12.26,9.219,22.131,34]tritetraconta-6,8,19(41),20,22(40),31,33,42-octaene.
| Compound Name | 39-oxa-1,4,11,14,17,24,29,36-octazapentacyclo[12.12.12.26,9.219,22.131,34]tritetraconta-6,8,19(41),20,22(40),31,33,42-octaene |
|---|---|
| PubChem CID | 102503341 |
| Molecular Formula | C34H52N8O |
| Molecular Weight | 588.85 g/mol |
| Exact Mass | 588.43 |
| IUPAC Name | 39-oxa-1,4,11,14,17,24,29,36-octazapentacyclo[12.12.12.26,9.219,22.131,34]tritetraconta-6,8,19(41),20,22(40),31,33,42-octaene |
| SMILES | c1cc2ccc1CNCCN1CCNCc3ccc(cc3)CNCCN(CCNC2)CCNCc2ccc(o2)CNCC1 |
| InChI | InChI=1S/C34H52N8O/c1-2-30-4-3-29(1)23-35-11-17-41-19-13-37-25-31-5-7-32(8-6-31)26-38-14-20-42(18-12-36-24-30)22-16-40-28-34-10-9-33(43-34)27-39-15-21-41/h1-10,35-40H,11-28H2 |
| InChIKey | GCFPNTMFENNWTB-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 91.80 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.85 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |