About 1-nitrodiazepane
1-nitrodiazepane (PubChem CID 18619293) has the molecular formula C5H11N3O2
and a molecular weight of 145.16 g/mol. Its IUPAC name is 1-nitrodiazepane.
Molecular Properties
| Compound Name | 1-nitrodiazepane |
| PubChem CID | 18619293 |
| Molecular Formula | C5H11N3O2 |
| Molecular Weight | 145.16 g/mol |
| Exact Mass | 145.09 |
| IUPAC Name | 1-nitrodiazepane |
| SMILES | O=[N+]([O-])N1CCCCCN1 |
| InChI | InChI=1S/C5H11N3O2/c9-8(10)7-5-3-1-2-4-6-7/h6H,1-5H2 |
| InChIKey | UKTVOPSUTNEFNN-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.16 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitrodiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitrodiazepane?
The IUPAC name of 1-nitrodiazepane (CID 18619293) is 1-nitrodiazepane.
What is the SMILES notation for 1-nitrodiazepane?
The canonical SMILES for 1-nitrodiazepane is O=[N+]([O-])N1CCCCCN1.
What is the InChIKey of 1-nitrodiazepane?
The InChIKey is UKTVOPSUTNEFNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11N3O2/c9-8(10)7-5-3-1-2-4-6-7/h6H,1-5H2.
What are the key properties of 1-nitrodiazepane?
1-nitrodiazepane has a molecular weight of 145.16 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitrodiazepane is sourced from PubChem (CID 18619293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).