C5H6N8O9 — CID 173345674
1,2-dinitroazetidine;N-(4-nitro-1,2,5-oxadiazol-3-yl)nitramide (PubChem CID 173345674) has the molecular formula C5H6N8O9 and a molecular weight of 322.15 g/mol. Its IUPAC name is 1,2-dinitroazetidine;N-(4-nitro-1,2,5-oxadiazol-3-yl)nitramide.
| Compound Name | 1,2-dinitroazetidine;N-(4-nitro-1,2,5-oxadiazol-3-yl)nitramide |
|---|---|
| PubChem CID | 173345674 |
| Molecular Formula | C5H6N8O9 |
| Molecular Weight | 322.15 g/mol |
| Exact Mass | 322.03 |
| IUPAC Name | 1,2-dinitroazetidine;N-(4-nitro-1,2,5-oxadiazol-3-yl)nitramide |
| SMILES | O=[N+]([O-])C1CCN1[N+](=O)[O-].O=[N+]([O-])Nc1nonc1[N+](=O)[O-] |
| InChI | InChI=1S/C3H5N3O4.C2HN5O5/c7-5(8)3-1-2-4(3)6(9)10;8-6(9)2-1(3-7(10)11)4-12-5-2/h3H,1-2H2;(H,3,4) |
| InChIKey | ZPYXYMXZZBSDNG-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 226.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.15 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|